C14H23N7O2 — CID 124755660
(2R)-2-[1-(2-methoxyethyl)tetrazol-5-yl]-4-[2-(3-methylpyrazol-1-yl)ethyl]morpholine (PubChem CID 124755660) has the molecular formula C14H23N7O2 and a molecular weight of 321.39 g/mol. Its IUPAC name is (2R)-2-[1-(2-methoxyethyl)tetrazol-5-yl]-4-[2-(3-methylpyrazol-1-yl)ethyl]morpholine.
| Compound Name | (2R)-2-[1-(2-methoxyethyl)tetrazol-5-yl]-4-[2-(3-methylpyrazol-1-yl)ethyl]morpholine |
|---|---|
| PubChem CID | 124755660 |
| Molecular Formula | C14H23N7O2 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (2R)-2-[1-(2-methoxyethyl)tetrazol-5-yl]-4-[2-(3-methylpyrazol-1-yl)ethyl]morpholine |
| SMILES | COCCn1nnnc1[C@H]1CN(CCn2ccc(C)n2)CCO1 |
| InChI | InChI=1S/C14H23N7O2/c1-12-3-4-20(16-12)6-5-19-7-10-23-13(11-19)14-15-17-18-21(14)8-9-22-2/h3-4,13H,5-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | QYAOHWFQMLIOAK-CYBMUJFWSA-N |
| XLogP | -0.10 |
| TPSA | 83.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |