C15H20N6O3 — CID 118778786
1-[2-[1-(2-methoxyethyl)tetrazol-5-yl]morpholin-4-yl]-2-pyridin-3-ylethanone (PubChem CID 118778786) has the molecular formula C15H20N6O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 1-[2-[1-(2-methoxyethyl)tetrazol-5-yl]morpholin-4-yl]-2-pyridin-3-ylethanone.
| Compound Name | 1-[2-[1-(2-methoxyethyl)tetrazol-5-yl]morpholin-4-yl]-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 118778786 |
| Molecular Formula | C15H20N6O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 1-[2-[1-(2-methoxyethyl)tetrazol-5-yl]morpholin-4-yl]-2-pyridin-3-ylethanone |
| SMILES | COCCn1nnnc1C1CN(C(=O)Cc2cccnc2)CCO1 |
| InChI | InChI=1S/C15H20N6O3/c1-23-7-6-21-15(17-18-19-21)13-11-20(5-8-24-13)14(22)9-12-3-2-4-16-10-12/h2-4,10,13H,5-9,11H2,1H3 |
| InChIKey | WYEOLSIHDYXWKC-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 95.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |