C19H27N5O3 — CID 99932469
1-[(2R)-2-[1-(2-methoxyethyl)tetrazol-5-yl]morpholin-4-yl]-3-methyl-3-phenylbutan-1-one (PubChem CID 99932469) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is 1-[(2R)-2-[1-(2-methoxyethyl)tetrazol-5-yl]morpholin-4-yl]-3-methyl-3-phenylbutan-1-one.
| Compound Name | 1-[(2R)-2-[1-(2-methoxyethyl)tetrazol-5-yl]morpholin-4-yl]-3-methyl-3-phenylbutan-1-one |
|---|---|
| PubChem CID | 99932469 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 1-[(2R)-2-[1-(2-methoxyethyl)tetrazol-5-yl]morpholin-4-yl]-3-methyl-3-phenylbutan-1-one |
| SMILES | COCCn1nnnc1[C@H]1CN(C(=O)CC(C)(C)c2ccccc2)CCO1 |
| InChI | InChI=1S/C19H27N5O3/c1-19(2,15-7-5-4-6-8-15)13-17(25)23-9-12-27-16(14-23)18-20-21-22-24(18)10-11-26-3/h4-8,16H,9-14H2,1-3H3/t16-/m1/s1 |
| InChIKey | UQEIHNNJPXAUAJ-MRXNPFEDSA-N |
| XLogP | 1.59 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |