C18H23N7O2 — CID 124841302
(2R)-2-[1-(2-methoxyethyl)tetrazol-5-yl]-4-[(4-pyrazol-1-ylphenyl)methyl]morpholine (PubChem CID 124841302) has the molecular formula C18H23N7O2 and a molecular weight of 369.43 g/mol. Its IUPAC name is (2R)-2-[1-(2-methoxyethyl)tetrazol-5-yl]-4-[(4-pyrazol-1-ylphenyl)methyl]morpholine.
| Compound Name | (2R)-2-[1-(2-methoxyethyl)tetrazol-5-yl]-4-[(4-pyrazol-1-ylphenyl)methyl]morpholine |
|---|---|
| PubChem CID | 124841302 |
| Molecular Formula | C18H23N7O2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (2R)-2-[1-(2-methoxyethyl)tetrazol-5-yl]-4-[(4-pyrazol-1-ylphenyl)methyl]morpholine |
| SMILES | COCCn1nnnc1[C@H]1CN(Cc2ccc(-n3cccn3)cc2)CCO1 |
| InChI | InChI=1S/C18H23N7O2/c1-26-11-10-25-18(20-21-22-25)17-14-23(9-12-27-17)13-15-3-5-16(6-4-15)24-8-2-7-19-24/h2-8,17H,9-14H2,1H3/t17-/m1/s1 |
| InChIKey | AFDVQHRIWMLTEZ-QGZVFWFLSA-N |
| XLogP | 1.08 |
| TPSA | 83.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |