C20H26INO — CID 129405336
N-[(2S)-1-(2-iodo-5-methoxyphenyl)propan-2-yl]-4-phenylbutan-1-amine (PubChem CID 129405336) has the molecular formula C20H26INO and a molecular weight of 423.34 g/mol. Its IUPAC name is N-[(2S)-1-(2-iodo-5-methoxyphenyl)propan-2-yl]-4-phenylbutan-1-amine.
| Compound Name | N-[(2S)-1-(2-iodo-5-methoxyphenyl)propan-2-yl]-4-phenylbutan-1-amine |
|---|---|
| PubChem CID | 129405336 |
| Molecular Formula | C20H26INO |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N-[(2S)-1-(2-iodo-5-methoxyphenyl)propan-2-yl]-4-phenylbutan-1-amine |
| SMILES | COc1ccc(I)c(C[C@H](C)NCCCCc2ccccc2)c1 |
| InChI | InChI=1S/C20H26INO/c1-16(14-18-15-19(23-2)11-12-20(18)21)22-13-7-6-10-17-8-4-3-5-9-17/h3-5,8-9,11-12,15-16,22H,6-7,10,13-14H2,1-2H3/t16-/m0/s1 |
| InChIKey | SATQYUALFXFXLQ-INIZCTEOSA-N |
| XLogP | 4.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|