C10H16O2 — CID 129405740
trans-tert-butyl (1S,2S)-2-ethenylcyclopropane-1-carboxylate (PubChem CID 129405740) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is trans-tert-butyl (1S,2S)-2-ethenylcyclopropane-1-carboxylate.
| Compound Name | trans-tert-butyl (1S,2S)-2-ethenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 129405740 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | trans-tert-butyl (1S,2S)-2-ethenylcyclopropane-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H16O2/c1-5-7-6-8(7)9(11)12-10(2,3)4/h5,7-8H,1,6H2,2-4H3/t7-,8+/m1/s1 |
| InChIKey | OTBHUSKYELMAMV-SFYZADRCSA-N |
| XLogP | 2.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|