C9H19N3O — CID 129406031
(2R)-N,4-diethylpiperazine-2-carboxamide (PubChem CID 129406031) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is (2R)-N,4-diethylpiperazine-2-carboxamide.
| Compound Name | (2R)-N,4-diethylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 129406031 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | (2R)-N,4-diethylpiperazine-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1CN(CC)CCN1 |
| InChI | InChI=1S/C9H19N3O/c1-3-10-9(13)8-7-12(4-2)6-5-11-8/h8,11H,3-7H2,1-2H3,(H,10,13)/t8-/m1/s1 |
| InChIKey | XRABAZLYOAJLPT-MRVPVSSYSA-N |
| XLogP | -0.58 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |