C17H15ClN2O3 — CID 129408540
6-chloro-5-[4-[(1S)-1-methoxyethyl]phenyl]-1H-indazole-3-carboxylic acid (PubChem CID 129408540) has the molecular formula C17H15ClN2O3 and a molecular weight of 330.77 g/mol. Its IUPAC name is 6-chloro-5-[4-[(1S)-1-methoxyethyl]phenyl]-1H-indazole-3-carboxylic acid.
| Compound Name | 6-chloro-5-[4-[(1S)-1-methoxyethyl]phenyl]-1H-indazole-3-carboxylic acid |
|---|---|
| PubChem CID | 129408540 |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 6-chloro-5-[4-[(1S)-1-methoxyethyl]phenyl]-1H-indazole-3-carboxylic acid |
| SMILES | CO[C@@H](C)c1ccc(-c2cc3c(C(=O)O)n[nH]c3cc2Cl)cc1 |
| InChI | InChI=1S/C17H15ClN2O3/c1-9(23-2)10-3-5-11(6-4-10)12-7-13-15(8-14(12)18)19-20-16(13)17(21)22/h3-9H,1-2H3,(H,19,20)(H,21,22)/t9-/m0/s1 |
| InChIKey | ICTZDPPAMKGTKY-VIFPVBQESA-N |
| XLogP | 4.29 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |