C14H13ClN4 — CID 151842688
5-[4-(aminomethyl)phenyl]-6-chloro-1H-indazol-3-amine (PubChem CID 151842688) has the molecular formula C14H13ClN4 and a molecular weight of 272.74 g/mol. Its IUPAC name is 5-[4-(aminomethyl)phenyl]-6-chloro-1H-indazol-3-amine.
| Compound Name | 5-[4-(aminomethyl)phenyl]-6-chloro-1H-indazol-3-amine |
|---|---|
| PubChem CID | 151842688 |
| Molecular Formula | C14H13ClN4 |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 5-[4-(aminomethyl)phenyl]-6-chloro-1H-indazol-3-amine |
| SMILES | NCc1ccc(-c2cc3c(N)n[nH]c3cc2Cl)cc1 |
| InChI | InChI=1S/C14H13ClN4/c15-12-6-13-11(14(17)19-18-13)5-10(12)9-3-1-8(7-16)2-4-9/h1-6H,7,16H2,(H3,17,18,19) |
| InChIKey | SGZRVQXDRDWDLH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |