C10H18ClNO — CID 129410315
(3aR,7aR)-2-(3-chloropropyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole (PubChem CID 129410315) has the molecular formula C10H18ClNO and a molecular weight of 203.71 g/mol. Its IUPAC name is (3aR,7aR)-2-(3-chloropropyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole.
| Compound Name | (3aR,7aR)-2-(3-chloropropyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole |
|---|---|
| PubChem CID | 129410315 |
| Molecular Formula | C10H18ClNO |
| Molecular Weight | 203.71 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | (3aR,7aR)-2-(3-chloropropyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole |
| SMILES | ClCCCN1C[C@@H]2CCOC[C@H]2C1 |
| InChI | InChI=1S/C10H18ClNO/c11-3-1-4-12-6-9-2-5-13-8-10(9)7-12/h9-10H,1-8H2/t9-,10+/m0/s1 |
| InChIKey | ADGRORTZHUJTKC-VHSXEESVSA-N |
| XLogP | 1.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.71 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|