C15H15FN4O3 — CID 129415168
(3R)-1-[1-(4-fluorophenyl)triazole-4-carbonyl]-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 129415168) has the molecular formula C15H15FN4O3 and a molecular weight of 318.31 g/mol. Its IUPAC name is (3R)-1-[1-(4-fluorophenyl)triazole-4-carbonyl]-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | (3R)-1-[1-(4-fluorophenyl)triazole-4-carbonyl]-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 129415168 |
| Molecular Formula | C15H15FN4O3 |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (3R)-1-[1-(4-fluorophenyl)triazole-4-carbonyl]-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | C[C@@]1(C(=O)O)CCN(C(=O)c2cn(-c3ccc(F)cc3)nn2)C1 |
| InChI | InChI=1S/C15H15FN4O3/c1-15(14(22)23)6-7-19(9-15)13(21)12-8-20(18-17-12)11-4-2-10(16)3-5-11/h2-5,8H,6-7,9H2,1H3,(H,22,23)/t15-/m1/s1 |
| InChIKey | BWMMYQYEHLSFKZ-OAHLLOKOSA-N |
| XLogP | 1.34 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |