C6H7NO2 — CID 129415835
1-methyl-4H-pyridine-2,3-dione (PubChem CID 129415835) has the molecular formula C6H7NO2 and a molecular weight of 125.13 g/mol. Its IUPAC name is 1-methyl-4H-pyridine-2,3-dione.
| Compound Name | 1-methyl-4H-pyridine-2,3-dione |
|---|---|
| PubChem CID | 129415835 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | 1-methyl-4H-pyridine-2,3-dione |
| SMILES | CN1C=CCC(=O)C1=O |
| InChI | InChI=1S/C6H7NO2/c1-7-4-2-3-5(8)6(7)9/h2,4H,3H2,1H3 |
| InChIKey | GEBZIGXXQAOQIG-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|