C16H19F3N4O — CID 129417514
N-[(2S)-3-methyl-1-(triazol-2-yl)butan-2-yl]-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 129417514) has the molecular formula C16H19F3N4O and a molecular weight of 340.35 g/mol. Its IUPAC name is N-[(2S)-3-methyl-1-(triazol-2-yl)butan-2-yl]-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(2S)-3-methyl-1-(triazol-2-yl)butan-2-yl]-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 129417514 |
| Molecular Formula | C16H19F3N4O |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-[(2S)-3-methyl-1-(triazol-2-yl)butan-2-yl]-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(C)[C@@H](Cn1nccn1)NC(=O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H19F3N4O/c1-11(2)14(10-23-20-7-8-21-23)22-15(24)9-12-3-5-13(6-4-12)16(17,18)19/h3-8,11,14H,9-10H2,1-2H3,(H,22,24)/t14-/m1/s1 |
| InChIKey | PJPANNIMXMODLY-CQSZACIVSA-N |
| XLogP | 2.68 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |