C24H36N4OS — CID 129419375
(7R)-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-7-methyl-2-(morpholin-4-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 129419375) has the molecular formula C24H36N4OS and a molecular weight of 428.65 g/mol. Its IUPAC name is (7R)-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-7-methyl-2-(morpholin-4-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | (7R)-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-7-methyl-2-(morpholin-4-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 129419375 |
| Molecular Formula | C24H36N4OS |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | (7R)-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-7-methyl-2-(morpholin-4-ylmethyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | C[C@@H]1CCc2c(sc3nc(CN4CCOCC4)nc(N[C@@H]4CCC[C@@H](C)[C@H]4C)c23)C1 |
| InChI | InChI=1S/C24H36N4OS/c1-15-7-8-18-20(13-15)30-24-22(18)23(25-19-6-4-5-16(2)17(19)3)26-21(27-24)14-28-9-11-29-12-10-28/h15-17,19H,4-14H2,1-3H3,(H,25,26,27)/t15-,16-,17-,19-/m1/s1 |
| InChIKey | YHJSWKLUVTWZPI-YWTNHNAXSA-N |
| XLogP | 4.88 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |