C23H28N4O2S — CID 9108949
(7S)-7-methyl-2-(morpholin-4-ylmethyl)-N-phenylmethoxy-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 9108949) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is (7S)-7-methyl-2-(morpholin-4-ylmethyl)-N-phenylmethoxy-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | (7S)-7-methyl-2-(morpholin-4-ylmethyl)-N-phenylmethoxy-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 9108949 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (7S)-7-methyl-2-(morpholin-4-ylmethyl)-N-phenylmethoxy-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | C[C@H]1CCc2c(sc3nc(CN4CCOCC4)nc(NOCc4ccccc4)c23)C1 |
| InChI | InChI=1S/C23H28N4O2S/c1-16-7-8-18-19(13-16)30-23-21(18)22(26-29-15-17-5-3-2-4-6-17)24-20(25-23)14-27-9-11-28-12-10-27/h2-6,16H,7-15H2,1H3,(H,24,25,26)/t16-/m0/s1 |
| InChIKey | KTZCKSXMIOLYSB-INIZCTEOSA-N |
| XLogP | 4.19 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|