C24H31N3O3 — CID 129419607
(1R)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2-(4-ethoxyphenyl)-3-oxo-1,4-dihydropyrrolo[1,2-a]pyrazine-1-carboxamide (PubChem CID 129419607) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is (1R)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2-(4-ethoxyphenyl)-3-oxo-1,4-dihydropyrrolo[1,2-a]pyrazine-1-carboxamide.
| Compound Name | (1R)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2-(4-ethoxyphenyl)-3-oxo-1,4-dihydropyrrolo[1,2-a]pyrazine-1-carboxamide |
|---|---|
| PubChem CID | 129419607 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | (1R)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2-(4-ethoxyphenyl)-3-oxo-1,4-dihydropyrrolo[1,2-a]pyrazine-1-carboxamide |
| SMILES | CCOc1ccc(N2C(=O)Cn3cccc3[C@@H]2C(=O)N[C@@H]2CCC[C@H](C)[C@H]2C)cc1 |
| InChI | InChI=1S/C24H31N3O3/c1-4-30-19-12-10-18(11-13-19)27-22(28)15-26-14-6-9-21(26)23(27)24(29)25-20-8-5-7-16(2)17(20)3/h6,9-14,16-17,20,23H,4-5,7-8,15H2,1-3H3,(H,25,29)/t16-,17+,20+,23+/m0/s1 |
| InChIKey | BZRLJWOZVHJELJ-PYDOFHOQSA-N |
| XLogP | 3.92 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |