C24H35N3O3S — CID 129420356
(11R)-11-methyl-N-[(1R,2R)-2-methylcyclohexyl]-9-oxo-10-(3-propan-2-yloxypropyl)-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide (PubChem CID 129420356) has the molecular formula C24H35N3O3S and a molecular weight of 445.63 g/mol. Its IUPAC name is (11R)-11-methyl-N-[(1R,2R)-2-methylcyclohexyl]-9-oxo-10-(3-propan-2-yloxypropyl)-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide.
| Compound Name | (11R)-11-methyl-N-[(1R,2R)-2-methylcyclohexyl]-9-oxo-10-(3-propan-2-yloxypropyl)-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 129420356 |
| Molecular Formula | C24H35N3O3S |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | (11R)-11-methyl-N-[(1R,2R)-2-methylcyclohexyl]-9-oxo-10-(3-propan-2-yloxypropyl)-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
| SMILES | CC(C)OCCCN1C(=O)c2cc3sccc3n2C[C@]1(C)C(=O)N[C@@H]1CCCC[C@H]1C |
| InChI | InChI=1S/C24H35N3O3S/c1-16(2)30-12-7-11-27-22(28)20-14-21-19(10-13-31-21)26(20)15-24(27,4)23(29)25-18-9-6-5-8-17(18)3/h10,13-14,16-18H,5-9,11-12,15H2,1-4H3,(H,25,29)/t17-,18-,24-/m1/s1 |
| InChIKey | NZMGZIJFAYGAPN-QZTZHPFYSA-N |
| XLogP | 4.43 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|