C23H33N3O3S — CID 92737226
(11R)-10-(3-ethoxypropyl)-11-methyl-N-[(1R,2S)-2-methylcyclohexyl]-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide (PubChem CID 92737226) has the molecular formula C23H33N3O3S and a molecular weight of 431.60 g/mol. Its IUPAC name is (11R)-10-(3-ethoxypropyl)-11-methyl-N-[(1R,2S)-2-methylcyclohexyl]-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide.
| Compound Name | (11R)-10-(3-ethoxypropyl)-11-methyl-N-[(1R,2S)-2-methylcyclohexyl]-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 92737226 |
| Molecular Formula | C23H33N3O3S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | (11R)-10-(3-ethoxypropyl)-11-methyl-N-[(1R,2S)-2-methylcyclohexyl]-9-oxo-5-thia-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
| SMILES | CCOCCCN1C(=O)c2cc3sccc3n2C[C@]1(C)C(=O)N[C@@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C23H33N3O3S/c1-4-29-12-7-11-26-21(27)19-14-20-18(10-13-30-20)25(19)15-23(26,3)22(28)24-17-9-6-5-8-16(17)2/h10,13-14,16-17H,4-9,11-12,15H2,1-3H3,(H,24,28)/t16-,17+,23+/m0/s1 |
| InChIKey | QCXJYTRUKQRHHM-YGKZAACZSA-N |
| XLogP | 4.04 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|