C16H30N2O3 — CID 129421266
1-methyl-3-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-[[(3R)-oxolan-3-yl]methyl]urea (PubChem CID 129421266) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-methyl-3-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-[[(3R)-oxolan-3-yl]methyl]urea.
| Compound Name | 1-methyl-3-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-[[(3R)-oxolan-3-yl]methyl]urea |
|---|---|
| PubChem CID | 129421266 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 1-methyl-3-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-[[(3R)-oxolan-3-yl]methyl]urea |
| SMILES | C[C@@H]1CCCC[C@H]1OCCNC(=O)N(C)C[C@H]1CCOC1 |
| InChI | InChI=1S/C16H30N2O3/c1-13-5-3-4-6-15(13)21-10-8-17-16(19)18(2)11-14-7-9-20-12-14/h13-15H,3-12H2,1-2H3,(H,17,19)/t13-,14-,15-/m1/s1 |
| InChIKey | AJFZYCRTHUSFQL-RBSFLKMASA-N |
| XLogP | 2.26 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|