C16H28N4O2 — CID 95622064
1-methyl-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-1-(2-pyrazol-1-ylethyl)urea (PubChem CID 95622064) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-methyl-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-1-(2-pyrazol-1-ylethyl)urea.
| Compound Name | 1-methyl-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-1-(2-pyrazol-1-ylethyl)urea |
|---|---|
| PubChem CID | 95622064 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 1-methyl-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethyl]-1-(2-pyrazol-1-ylethyl)urea |
| SMILES | C[C@@H]1CCCC[C@@H]1OCCNC(=O)N(C)CCn1cccn1 |
| InChI | InChI=1S/C16H28N4O2/c1-14-6-3-4-7-15(14)22-13-9-17-16(21)19(2)11-12-20-10-5-8-18-20/h5,8,10,14-15H,3-4,6-7,9,11-13H2,1-2H3,(H,17,21)/t14-,15+/m1/s1 |
| InChIKey | NMYQXSIGSWLIME-CABCVRRESA-N |
| XLogP | 2.12 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|