C16H19F3N4O — CID 56787636
1-methyl-1-(2-pyrazol-1-ylethyl)-3-[2-[2-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 56787636) has the molecular formula C16H19F3N4O and a molecular weight of 340.35 g/mol. Its IUPAC name is 1-methyl-1-(2-pyrazol-1-ylethyl)-3-[2-[2-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-methyl-1-(2-pyrazol-1-ylethyl)-3-[2-[2-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 56787636 |
| Molecular Formula | C16H19F3N4O |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-methyl-1-(2-pyrazol-1-ylethyl)-3-[2-[2-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | CN(CCn1cccn1)C(=O)NCCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H19F3N4O/c1-22(11-12-23-10-4-8-21-23)15(24)20-9-7-13-5-2-3-6-14(13)16(17,18)19/h2-6,8,10H,7,9,11-12H2,1H3,(H,20,24) |
| InChIKey | VCVHBCBIGOCBNZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |