C20H27N3O2 — CID 51948680
N-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]-2-(4-pyrazol-1-ylphenyl)acetamide (PubChem CID 51948680) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is N-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]-2-(4-pyrazol-1-ylphenyl)acetamide.
| Compound Name | N-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]-2-(4-pyrazol-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 51948680 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N-[2-[(1S,2S)-2-methylcyclohexyl]oxyethyl]-2-(4-pyrazol-1-ylphenyl)acetamide |
| SMILES | C[C@H]1CCCC[C@@H]1OCCNC(=O)Cc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C20H27N3O2/c1-16-5-2-3-6-19(16)25-14-12-21-20(24)15-17-7-9-18(10-8-17)23-13-4-11-22-23/h4,7-11,13,16,19H,2-3,5-6,12,14-15H2,1H3,(H,21,24)/t16-,19-/m0/s1 |
| InChIKey | PUGUJTSFSLEHFW-LPHOPBHVSA-N |
| XLogP | 3.13 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|