C16H18F3N3O2 — CID 86990308
2-(4-pyrazol-1-ylphenyl)-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide (PubChem CID 86990308) has the molecular formula C16H18F3N3O2 and a molecular weight of 341.33 g/mol. Its IUPAC name is 2-(4-pyrazol-1-ylphenyl)-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide.
| Compound Name | 2-(4-pyrazol-1-ylphenyl)-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide |
|---|---|
| PubChem CID | 86990308 |
| Molecular Formula | C16H18F3N3O2 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-(4-pyrazol-1-ylphenyl)-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide |
| SMILES | O=C(Cc1ccc(-n2cccn2)cc1)NCCCOCC(F)(F)F |
| InChI | InChI=1S/C16H18F3N3O2/c17-16(18,19)12-24-10-2-7-20-15(23)11-13-3-5-14(6-4-13)22-9-1-8-21-22/h1,3-6,8-9H,2,7,10-12H2,(H,20,23) |
| InChIKey | MFQZFQYOPZDRGZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|