C12H12F3N3O — CID 82712652
1-(4-pyrazol-1-ylphenyl)-N-(2,2,2-trifluoroethoxy)methanamine (PubChem CID 82712652) has the molecular formula C12H12F3N3O and a molecular weight of 271.24 g/mol. Its IUPAC name is 1-(4-pyrazol-1-ylphenyl)-N-(2,2,2-trifluoroethoxy)methanamine.
| Compound Name | 1-(4-pyrazol-1-ylphenyl)-N-(2,2,2-trifluoroethoxy)methanamine |
|---|---|
| PubChem CID | 82712652 |
| Molecular Formula | C12H12F3N3O |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 1-(4-pyrazol-1-ylphenyl)-N-(2,2,2-trifluoroethoxy)methanamine |
| SMILES | FC(F)(F)CONCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C12H12F3N3O/c13-12(14,15)9-19-17-8-10-2-4-11(5-3-10)18-7-1-6-16-18/h1-7,17H,8-9H2 |
| InChIKey | PURMRXJZGZQUSL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|