C19H25N3O — CID 98680919
N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(4-pyrazol-1-ylphenyl)acetamide (PubChem CID 98680919) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(4-pyrazol-1-ylphenyl)acetamide.
| Compound Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(4-pyrazol-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 98680919 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(4-pyrazol-1-ylphenyl)acetamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@H]1NC(=O)Cc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C19H25N3O/c1-14-5-3-6-18(15(14)2)21-19(23)13-16-7-9-17(10-8-16)22-12-4-11-20-22/h4,7-12,14-15,18H,3,5-6,13H2,1-2H3,(H,21,23)/t14-,15+,18-/m1/s1 |
| InChIKey | WIQNOYAIUYGHGP-RVKKMQEKSA-N |
| XLogP | 3.36 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |