C16H18N4O3 — CID 86991486
N'-[2-(4-pyrazol-1-ylphenyl)acetyl]oxolane-2-carbohydrazide (PubChem CID 86991486) has the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. Its IUPAC name is N'-[2-(4-pyrazol-1-ylphenyl)acetyl]oxolane-2-carbohydrazide.
| Compound Name | N'-[2-(4-pyrazol-1-ylphenyl)acetyl]oxolane-2-carbohydrazide |
|---|---|
| PubChem CID | 86991486 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N'-[2-(4-pyrazol-1-ylphenyl)acetyl]oxolane-2-carbohydrazide |
| SMILES | O=C(Cc1ccc(-n2cccn2)cc1)NNC(=O)C1CCCO1 |
| InChI | InChI=1S/C16H18N4O3/c21-15(18-19-16(22)14-3-1-10-23-14)11-12-4-6-13(7-5-12)20-9-2-8-17-20/h2,4-9,14H,1,3,10-11H2,(H,18,21)(H,19,22) |
| InChIKey | AXBAWFVDMKOEDQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|