C14H15F3N2O4 — CID 60556517
N'-[2-[4-(trifluoromethoxy)phenyl]acetyl]oxolane-2-carbohydrazide (PubChem CID 60556517) has the molecular formula C14H15F3N2O4 and a molecular weight of 332.28 g/mol. Its IUPAC name is N'-[2-[4-(trifluoromethoxy)phenyl]acetyl]oxolane-2-carbohydrazide.
| Compound Name | N'-[2-[4-(trifluoromethoxy)phenyl]acetyl]oxolane-2-carbohydrazide |
|---|---|
| PubChem CID | 60556517 |
| Molecular Formula | C14H15F3N2O4 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N'-[2-[4-(trifluoromethoxy)phenyl]acetyl]oxolane-2-carbohydrazide |
| SMILES | O=C(Cc1ccc(OC(F)(F)F)cc1)NNC(=O)C1CCCO1 |
| InChI | InChI=1S/C14H15F3N2O4/c15-14(16,17)23-10-5-3-9(4-6-10)8-12(20)18-19-13(21)11-2-1-7-22-11/h3-6,11H,1-2,7-8H2,(H,18,20)(H,19,21) |
| InChIKey | BTYPBJXGWTTYFJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|