About (2R)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-pyrazol-1-ylpropan-2-amine
(2R)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-pyrazol-1-ylpropan-2-amine (PubChem CID 124810591) has the molecular formula C15H27N3O
and a molecular weight of 265.40 g/mol. Its IUPAC name is (2R)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-pyrazol-1-ylpropan-2-amine.
Molecular Properties
| Compound Name | (2R)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-pyrazol-1-ylpropan-2-amine |
| PubChem CID | 124810591 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | (2R)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-pyrazol-1-ylpropan-2-amine |
| SMILES | C[C@H](Cn1cccn1)NCCO[C@@H]1CCCC[C@H]1C |
| InChI | InChI=1S/C15H27N3O/c1-13-6-3-4-7-15(13)19-11-9-16-14(2)12-18-10-5-8-17-18/h5,8,10,13-16H,3-4,6-7,9,11-12H2,1-2H3/t13-,14-,15-/m1/s1 |
| InChIKey | UYMSBDFZYNFHIV-RBSFLKMASA-N |
| XLogP | 2.46 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-pyrazol-1-ylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-pyrazol-1-ylpropan-2-amine?
The IUPAC name of (2R)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-pyrazol-1-ylpropan-2-amine (CID 124810591) is (2R)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-pyrazol-1-ylpropan-2-amine.
What is the SMILES notation for (2R)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-pyrazol-1-ylpropan-2-amine?
The canonical SMILES for (2R)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-pyrazol-1-ylpropan-2-amine is C[C@H](Cn1cccn1)NCCO[C@@H]1CCCC[C@H]1C.
What is the InChIKey of (2R)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-pyrazol-1-ylpropan-2-amine?
The InChIKey is UYMSBDFZYNFHIV-RBSFLKMASA-N. The full InChI is InChI=1S/C15H27N3O/c1-13-6-3-4-7-15(13)19-11-9-16-14(2)12-18-10-5-8-17-18/h5,8,10,13-16H,3-4,6-7,9,11-12H2,1-2H3/t13-,14-,15-/m1/s1.
What are the key properties of (2R)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-pyrazol-1-ylpropan-2-amine?
(2R)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-pyrazol-1-ylpropan-2-amine has a molecular weight of 265.40 g/mol, XLogP of 2.46, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-pyrazol-1-ylpropan-2-amine is sourced from PubChem (CID 124810591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).