C11H17N5O2 — CID 95611974
3-[2-[[(2R)-1-pyrazol-1-ylpropan-2-yl]amino]ethyl]imidazolidine-2,4-dione (PubChem CID 95611974) has the molecular formula C11H17N5O2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 3-[2-[[(2R)-1-pyrazol-1-ylpropan-2-yl]amino]ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-[[(2R)-1-pyrazol-1-ylpropan-2-yl]amino]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95611974 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 3-[2-[[(2R)-1-pyrazol-1-ylpropan-2-yl]amino]ethyl]imidazolidine-2,4-dione |
| SMILES | C[C@H](Cn1cccn1)NCCN1C(=O)CNC1=O |
| InChI | InChI=1S/C11H17N5O2/c1-9(8-15-5-2-3-14-15)12-4-6-16-10(17)7-13-11(16)18/h2-3,5,9,12H,4,6-8H2,1H3,(H,13,18)/t9-/m1/s1 |
| InChIKey | HGWKOGWSZVZXTN-SECBINFHSA-N |
| XLogP | -0.59 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|