C23H26ClN3O — CID 129422166
(2S)-2-(5-chloro-3-phenylindazol-1-yl)-N-[(1R,2R)-2-methylcyclohexyl]propanamide (PubChem CID 129422166) has the molecular formula C23H26ClN3O and a molecular weight of 395.93 g/mol. Its IUPAC name is (2S)-2-(5-chloro-3-phenylindazol-1-yl)-N-[(1R,2R)-2-methylcyclohexyl]propanamide.
| Compound Name | (2S)-2-(5-chloro-3-phenylindazol-1-yl)-N-[(1R,2R)-2-methylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 129422166 |
| Molecular Formula | C23H26ClN3O |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | (2S)-2-(5-chloro-3-phenylindazol-1-yl)-N-[(1R,2R)-2-methylcyclohexyl]propanamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)[C@H](C)n1nc(-c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C23H26ClN3O/c1-15-8-6-7-11-20(15)25-23(28)16(2)27-21-13-12-18(24)14-19(21)22(26-27)17-9-4-3-5-10-17/h3-5,9-10,12-16,20H,6-8,11H2,1-2H3,(H,25,28)/t15-,16+,20-/m1/s1 |
| InChIKey | FTORDYVUBYDXKU-GQIGUUNPSA-N |
| XLogP | 5.61 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |