C16H23N3O2S — CID 129424088
2-[(2S)-1-[(2S)-2-methylbutyl]sulfonylpyrrolidin-2-yl]-1H-benzimidazole (PubChem CID 129424088) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 2-[(2S)-1-[(2S)-2-methylbutyl]sulfonylpyrrolidin-2-yl]-1H-benzimidazole.
| Compound Name | 2-[(2S)-1-[(2S)-2-methylbutyl]sulfonylpyrrolidin-2-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 129424088 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-[(2S)-1-[(2S)-2-methylbutyl]sulfonylpyrrolidin-2-yl]-1H-benzimidazole |
| SMILES | CC[C@H](C)CS(=O)(=O)N1CCC[C@H]1c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H23N3O2S/c1-3-12(2)11-22(20,21)19-10-6-9-15(19)16-17-13-7-4-5-8-14(13)18-16/h4-5,7-8,12,15H,3,6,9-11H2,1-2H3,(H,17,18)/t12-,15-/m0/s1 |
| InChIKey | SKRVCNNPZCPHOG-WFASDCNBSA-N |
| XLogP | 3.08 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |