C21H19N5O2S — CID 171916398
2-[1-(4-pyrimidin-5-ylphenyl)sulfonylpyrrolidin-2-yl]-1H-benzimidazole (PubChem CID 171916398) has the molecular formula C21H19N5O2S and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-[1-(4-pyrimidin-5-ylphenyl)sulfonylpyrrolidin-2-yl]-1H-benzimidazole.
| Compound Name | 2-[1-(4-pyrimidin-5-ylphenyl)sulfonylpyrrolidin-2-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 171916398 |
| Molecular Formula | C21H19N5O2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-[1-(4-pyrimidin-5-ylphenyl)sulfonylpyrrolidin-2-yl]-1H-benzimidazole |
| SMILES | O=S(=O)(c1ccc(-c2cncnc2)cc1)N1CCCC1c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H19N5O2S/c27-29(28,17-9-7-15(8-10-17)16-12-22-14-23-13-16)26-11-3-6-20(26)21-24-18-4-1-2-5-19(18)25-21/h1-2,4-5,7-10,12-14,20H,3,6,11H2,(H,24,25) |
| InChIKey | KUDZAEBMOPIFEW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |