C18H31N5O2 — CID 129425218
tert-butyl N-[[(1S,2S)-2-[[(8S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]amino]cyclopentyl]methyl]carbamate (PubChem CID 129425218) has the molecular formula C18H31N5O2 and a molecular weight of 349.48 g/mol. Its IUPAC name is tert-butyl N-[[(1S,2S)-2-[[(8S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]amino]cyclopentyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(1S,2S)-2-[[(8S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]amino]cyclopentyl]methyl]carbamate |
|---|---|
| PubChem CID | 129425218 |
| Molecular Formula | C18H31N5O2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | tert-butyl N-[[(1S,2S)-2-[[(8S)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]amino]cyclopentyl]methyl]carbamate |
| SMILES | Cc1nc2n(n1)CCC[C@@H]2N[C@H]1CCC[C@H]1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31N5O2/c1-12-20-16-15(9-6-10-23(16)22-12)21-14-8-5-7-13(14)11-19-17(24)25-18(2,3)4/h13-15,21H,5-11H2,1-4H3,(H,19,24)/t13-,14-,15-/m0/s1 |
| InChIKey | LIMXGPNKFZCNHR-KKUMJFAQSA-N |
| XLogP | 2.70 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |