C24H30N4O3 — CID 129426818
(4aS,5S)-8-nitro-N-(2-phenylethyl)-3-propan-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 129426818) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is (4aS,5S)-8-nitro-N-(2-phenylethyl)-3-propan-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5S)-8-nitro-N-(2-phenylethyl)-3-propan-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 129426818 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (4aS,5S)-8-nitro-N-(2-phenylethyl)-3-propan-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | CC(C)N1CCN2c3ccc([N+](=O)[O-])cc3C[C@H](C(=O)NCCc3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C24H30N4O3/c1-17(2)26-12-13-27-22-9-8-20(28(30)31)14-19(22)15-21(23(27)16-26)24(29)25-11-10-18-6-4-3-5-7-18/h3-9,14,17,21,23H,10-13,15-16H2,1-2H3,(H,25,29)/t21-,23+/m0/s1 |
| InChIKey | BGHKSHKMTXEAFR-JTHBVZDNSA-N |
| XLogP | 3.03 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|