C27H37N3O2S — CID 129427428
1-[4-[(2S)-2-[(4R)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]propanoyl]piperazin-1-yl]hexan-1-one (PubChem CID 129427428) has the molecular formula C27H37N3O2S and a molecular weight of 467.68 g/mol. Its IUPAC name is 1-[4-[(2S)-2-[(4R)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]propanoyl]piperazin-1-yl]hexan-1-one.
| Compound Name | 1-[4-[(2S)-2-[(4R)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]propanoyl]piperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 129427428 |
| Molecular Formula | C27H37N3O2S |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 1-[4-[(2S)-2-[(4R)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]propanoyl]piperazin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCN(C(=O)[C@H](C)N2CCc3sccc3[C@H]2c2ccccc2C)CC1 |
| InChI | InChI=1S/C27H37N3O2S/c1-4-5-6-11-25(31)28-15-17-29(18-16-28)27(32)21(3)30-14-12-24-23(13-19-33-24)26(30)22-10-8-7-9-20(22)2/h7-10,13,19,21,26H,4-6,11-12,14-18H2,1-3H3/t21-,26+/m0/s1 |
| InChIKey | KHSPAIOCCREAAE-HFZDXXHNSA-N |
| XLogP | 4.64 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|