C30H43N3O2S — CID 46078428
1-[4-[3-[4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]propanoyl]piperazin-1-yl]nonan-1-one (PubChem CID 46078428) has the molecular formula C30H43N3O2S and a molecular weight of 509.76 g/mol. Its IUPAC name is 1-[4-[3-[4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]propanoyl]piperazin-1-yl]nonan-1-one.
| Compound Name | 1-[4-[3-[4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]propanoyl]piperazin-1-yl]nonan-1-one |
|---|---|
| PubChem CID | 46078428 |
| Molecular Formula | C30H43N3O2S |
| Molecular Weight | 509.76 g/mol |
| Exact Mass | 509.31 |
| IUPAC Name | 1-[4-[3-[4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]propanoyl]piperazin-1-yl]nonan-1-one |
| SMILES | CCCCCCCCC(=O)N1CCN(C(=O)CCN2CCc3sccc3C2c2ccccc2C)CC1 |
| InChI | InChI=1S/C30H43N3O2S/c1-3-4-5-6-7-8-13-28(34)31-19-21-32(22-20-31)29(35)15-18-33-17-14-27-26(16-23-36-27)30(33)25-12-10-9-11-24(25)2/h9-12,16,23,30H,3-8,13-15,17-22H2,1-2H3 |
| InChIKey | KBIGMKAAQCFSKS-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.76 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|