C29H41N3O2S — CID 98396545
1-[4-[2-[(4R)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]acetyl]-1,4-diazepan-1-yl]nonan-1-one (PubChem CID 98396545) has the molecular formula C29H41N3O2S and a molecular weight of 495.73 g/mol. Its IUPAC name is 1-[4-[2-[(4R)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]acetyl]-1,4-diazepan-1-yl]nonan-1-one.
| Compound Name | 1-[4-[2-[(4R)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]acetyl]-1,4-diazepan-1-yl]nonan-1-one |
|---|---|
| PubChem CID | 98396545 |
| Molecular Formula | C29H41N3O2S |
| Molecular Weight | 495.73 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | 1-[4-[2-[(4R)-4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]acetyl]-1,4-diazepan-1-yl]nonan-1-one |
| SMILES | CCCCCCCCC(=O)N1CCCN(C(=O)CN2CCc3sccc3[C@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C29H41N3O2S/c1-2-3-4-5-6-10-14-27(33)30-17-11-18-31(21-20-30)28(34)23-32-19-15-26-25(16-22-35-26)29(32)24-12-8-7-9-13-24/h7-9,12-13,16,22,29H,2-6,10-11,14-15,17-21,23H2,1H3/t29-/m1/s1 |
| InChIKey | MUJZHWSOUNBVKZ-GDLZYMKVSA-N |
| XLogP | 5.51 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.73 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|