C32H38FN3O2S — CID 46074929
2-[4-(3-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-1-[4-(4-pentylbenzoyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 46074929) has the molecular formula C32H38FN3O2S and a molecular weight of 547.74 g/mol. Its IUPAC name is 2-[4-(3-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-1-[4-(4-pentylbenzoyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2-[4-(3-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-1-[4-(4-pentylbenzoyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 46074929 |
| Molecular Formula | C32H38FN3O2S |
| Molecular Weight | 547.74 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | 2-[4-(3-fluorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-1-[4-(4-pentylbenzoyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CCCCCc1ccc(C(=O)N2CCCN(C(=O)CN3CCc4sccc4C3c3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C32H38FN3O2S/c1-2-3-4-7-24-10-12-25(13-11-24)32(38)35-17-6-16-34(19-20-35)30(37)23-36-18-14-29-28(15-21-39-29)31(36)26-8-5-9-27(33)22-26/h5,8-13,15,21-22,31H,2-4,6-7,14,16-20,23H2,1H3 |
| InChIKey | LRUQQTINBXUAMZ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.74 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|