C33H41N3O2S — CID 98406736
2-[(4S)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-1-[4-(4-pentylbenzoyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 98406736) has the molecular formula C33H41N3O2S and a molecular weight of 543.78 g/mol. Its IUPAC name is 2-[(4S)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-1-[4-(4-pentylbenzoyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2-[(4S)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-1-[4-(4-pentylbenzoyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 98406736 |
| Molecular Formula | C33H41N3O2S |
| Molecular Weight | 543.78 g/mol |
| Exact Mass | 543.29 |
| IUPAC Name | 2-[(4S)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-1-[4-(4-pentylbenzoyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CCCCCc1ccc(C(=O)N2CCCN(C(=O)CN3CCc4sccc4[C@@H]3c3ccccc3C)CC2)cc1 |
| InChI | InChI=1S/C33H41N3O2S/c1-3-4-5-10-26-12-14-27(15-13-26)33(38)35-19-8-18-34(21-22-35)31(37)24-36-20-16-30-29(17-23-39-30)32(36)28-11-7-6-9-25(28)2/h6-7,9,11-15,17,23,32H,3-5,8,10,16,18-22,24H2,1-2H3/t32-/m0/s1 |
| InChIKey | NYZYFSQUXJQTBB-YTTGMZPUSA-N |
| XLogP | 6.11 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.78 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|