C29H32N4O4S — CID 46078432
3-[4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-1-[4-(4-nitrobenzoyl)-1,4-diazepan-1-yl]propan-1-one (PubChem CID 46078432) has the molecular formula C29H32N4O4S and a molecular weight of 532.67 g/mol. Its IUPAC name is 3-[4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-1-[4-(4-nitrobenzoyl)-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | 3-[4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-1-[4-(4-nitrobenzoyl)-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 46078432 |
| Molecular Formula | C29H32N4O4S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | 3-[4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-1-[4-(4-nitrobenzoyl)-1,4-diazepan-1-yl]propan-1-one |
| SMILES | Cc1ccccc1C1c2ccsc2CCN1CCC(=O)N1CCCN(C(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C29H32N4O4S/c1-21-5-2-3-6-24(21)28-25-13-20-38-26(25)11-16-31(28)17-12-27(34)30-14-4-15-32(19-18-30)29(35)22-7-9-23(10-8-22)33(36)37/h2-3,5-10,13,20,28H,4,11-12,14-19H2,1H3 |
| InChIKey | XKSZODOAFZAZMD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|