C14H21N5O — CID 129427472
(3-aminopyrazin-2-yl)-[(2R)-2-[(2S)-1-methylpyrrolidin-2-yl]pyrrolidin-1-yl]methanone (PubChem CID 129427472) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is (3-aminopyrazin-2-yl)-[(2R)-2-[(2S)-1-methylpyrrolidin-2-yl]pyrrolidin-1-yl]methanone.
| Compound Name | (3-aminopyrazin-2-yl)-[(2R)-2-[(2S)-1-methylpyrrolidin-2-yl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 129427472 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | (3-aminopyrazin-2-yl)-[(2R)-2-[(2S)-1-methylpyrrolidin-2-yl]pyrrolidin-1-yl]methanone |
| SMILES | CN1CCC[C@H]1[C@H]1CCCN1C(=O)c1nccnc1N |
| InChI | InChI=1S/C14H21N5O/c1-18-8-2-4-10(18)11-5-3-9-19(11)14(20)12-13(15)17-7-6-16-12/h6-7,10-11H,2-5,8-9H2,1H3,(H2,15,17)/t10-,11+/m0/s1 |
| InChIKey | BPDZCVYHKYEVAC-WDEREUQCSA-N |
| XLogP | 0.76 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |