C15H22N4O — CID 97092506
[(4R,4aR,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(3-aminopyrazin-2-yl)methanone (PubChem CID 97092506) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is [(4R,4aR,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(3-aminopyrazin-2-yl)methanone.
| Compound Name | [(4R,4aR,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(3-aminopyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 97092506 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | [(4R,4aR,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-(3-aminopyrazin-2-yl)methanone |
| SMILES | C[C@@H]1CCN(C(=O)c2nccnc2N)[C@@H]2CCCC[C@H]12 |
| InChI | InChI=1S/C15H22N4O/c1-10-6-9-19(12-5-3-2-4-11(10)12)15(20)13-14(16)18-8-7-17-13/h7-8,10-12H,2-6,9H2,1H3,(H2,16,18)/t10-,11-,12-/m1/s1 |
| InChIKey | QNKVFMWVSUHKDK-IJLUTSLNSA-N |
| XLogP | 2.10 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |