C22H29N3O — CID 55931165
(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanone (PubChem CID 55931165) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is (2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanone.
| Compound Name | (2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 55931165 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | (2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCC(C)C3CCCCC32)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C22H29N3O/c1-15-11-13-24(20-9-5-4-8-18(15)20)22(26)19-14-16(2)25(17(19)3)21-10-6-7-12-23-21/h6-7,10,12,14-15,18,20H,4-5,8-9,11,13H2,1-3H3 |
| InChIKey | FGSVKTQHXUUJJT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|