C18H23N3O3 — CID 97251314
(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-[(3R)-3-(2-hydroxyethyl)morpholin-4-yl]methanone (PubChem CID 97251314) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-[(3R)-3-(2-hydroxyethyl)morpholin-4-yl]methanone.
| Compound Name | (2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-[(3R)-3-(2-hydroxyethyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 97251314 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-[(3R)-3-(2-hydroxyethyl)morpholin-4-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCOC[C@H]2CCO)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C18H23N3O3/c1-13-11-16(14(2)21(13)17-5-3-4-7-19-17)18(23)20-8-10-24-12-15(20)6-9-22/h3-5,7,11,15,22H,6,8-10,12H2,1-2H3/t15-/m1/s1 |
| InChIKey | VSHINOGWGSIASF-OAHLLOKOSA-N |
| XLogP | 1.71 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|