C18H19N5O3 — CID 97331532
(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-[(3R)-3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]methanone (PubChem CID 97331532) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is (2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-[(3R)-3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]methanone.
| Compound Name | (2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-[(3R)-3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 97331532 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-[(3R)-3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCOC[C@H]2c2ncon2)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C18H19N5O3/c1-12-9-14(13(2)23(12)16-5-3-4-6-19-16)18(24)22-7-8-25-10-15(22)17-20-11-26-21-17/h3-6,9,11,15H,7-8,10H2,1-2H3/t15-/m0/s1 |
| InChIKey | KJWSNOLHVUGVKV-HNNXBMFYSA-N |
| XLogP | 2.09 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|