About [(3R)-3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]-(4-phenoxy-2-pyridinyl)methanone
[(3R)-3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]-(4-phenoxy-2-pyridinyl)methanone (PubChem CID 97341023) has the molecular formula C18H16N4O4
and a molecular weight of 352.35 g/mol. Its IUPAC name is [(3R)-3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]-(4-phenoxy-2-pyridinyl)methanone.
Molecular Properties
| Compound Name | [(3R)-3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]-(4-phenoxy-2-pyridinyl)methanone |
| PubChem CID | 97341023 |
| Molecular Formula | C18H16N4O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | [(3R)-3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]-(4-phenoxy-2-pyridinyl)methanone |
| SMILES | O=C(c1cc(Oc2ccccc2)ccn1)N1CCOC[C@H]1c1ncon1 |
| InChI | InChI=1S/C18H16N4O4/c23-18(22-8-9-24-11-16(22)17-20-12-25-21-17)15-10-14(6-7-19-15)26-13-4-2-1-3-5-13/h1-7,10,12,16H,8-9,11H2/t16-/m0/s1 |
| InChIKey | QOGFVLQHYAUDEE-INIZCTEOSA-N |
| XLogP | 2.47 |
| TPSA | 90.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(3R)-3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]-(4-phenoxy-2-pyridinyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]-(4-phenoxy-2-pyridinyl)methanone?
The IUPAC name of [(3R)-3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]-(4-phenoxy-2-pyridinyl)methanone (CID 97341023) is [(3R)-3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]-(4-phenoxy-2-pyridinyl)methanone.
What is the SMILES notation for [(3R)-3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]-(4-phenoxy-2-pyridinyl)methanone?
The canonical SMILES for [(3R)-3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]-(4-phenoxy-2-pyridinyl)methanone is O=C(c1cc(Oc2ccccc2)ccn1)N1CCOC[C@H]1c1ncon1.
What is the InChIKey of [(3R)-3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]-(4-phenoxy-2-pyridinyl)methanone?
The InChIKey is QOGFVLQHYAUDEE-INIZCTEOSA-N. The full InChI is InChI=1S/C18H16N4O4/c23-18(22-8-9-24-11-16(22)17-20-12-25-21-17)15-10-14(6-7-19-15)26-13-4-2-1-3-5-13/h1-7,10,12,16H,8-9,11H2/t16-/m0/s1.
What are the key properties of [(3R)-3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]-(4-phenoxy-2-pyridinyl)methanone?
[(3R)-3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]-(4-phenoxy-2-pyridinyl)methanone has a molecular weight of 352.35 g/mol, XLogP of 2.47, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-3-(1,2,4-oxadiazol-3-yl)morpholin-4-yl]-(4-phenoxy-2-pyridinyl)methanone is sourced from PubChem (CID 97341023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).