C18H24N4O — CID 120571350
(2,3-dimethylpiperazin-1-yl)-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methanone (PubChem CID 120571350) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is (2,3-dimethylpiperazin-1-yl)-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methanone.
| Compound Name | (2,3-dimethylpiperazin-1-yl)-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methanone |
|---|---|
| PubChem CID | 120571350 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | (2,3-dimethylpiperazin-1-yl)-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCNC(C)C2C)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C18H24N4O/c1-12-11-16(15(4)22(12)17-7-5-6-8-20-17)18(23)21-10-9-19-13(2)14(21)3/h5-8,11,13-14,19H,9-10H2,1-4H3 |
| InChIKey | ATMOBQMQQBWXDD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|