C36H45N3O2 — CID 129428058
(3R)-3-(1,7-diethylindol-3-yl)-N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]-3-(3-phenoxyphenyl)propanamide (PubChem CID 129428058) has the molecular formula C36H45N3O2 and a molecular weight of 551.78 g/mol. Its IUPAC name is (3R)-3-(1,7-diethylindol-3-yl)-N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]-3-(3-phenoxyphenyl)propanamide.
| Compound Name | (3R)-3-(1,7-diethylindol-3-yl)-N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]-3-(3-phenoxyphenyl)propanamide |
|---|---|
| PubChem CID | 129428058 |
| Molecular Formula | C36H45N3O2 |
| Molecular Weight | 551.78 g/mol |
| Exact Mass | 551.35 |
| IUPAC Name | (3R)-3-(1,7-diethylindol-3-yl)-N-[3-[(2R)-2-methylpiperidin-1-yl]propyl]-3-(3-phenoxyphenyl)propanamide |
| SMILES | CCc1cccc2c([C@H](CC(=O)NCCCN3CCCC[C@H]3C)c3cccc(Oc4ccccc4)c3)cn(CC)c12 |
| InChI | InChI=1S/C36H45N3O2/c1-4-28-15-12-20-32-34(26-38(5-2)36(28)32)33(25-35(40)37-21-13-23-39-22-10-9-14-27(39)3)29-16-11-19-31(24-29)41-30-17-7-6-8-18-30/h6-8,11-12,15-20,24,26-27,33H,4-5,9-10,13-14,21-23,25H2,1-3H3,(H,37,40)/t27-,33-/m1/s1 |
| InChIKey | YKFYHRMKBFWPNF-ZORMNXRFSA-N |
| XLogP | 7.92 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.78 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|