C28H29ClN2O — CID 93120110
(3R)-N-benzyl-3-(4-chlorophenyl)-3-(1,7-diethylindol-3-yl)propanamide (PubChem CID 93120110) has the molecular formula C28H29ClN2O and a molecular weight of 445.01 g/mol. Its IUPAC name is (3R)-N-benzyl-3-(4-chlorophenyl)-3-(1,7-diethylindol-3-yl)propanamide.
| Compound Name | (3R)-N-benzyl-3-(4-chlorophenyl)-3-(1,7-diethylindol-3-yl)propanamide |
|---|---|
| PubChem CID | 93120110 |
| Molecular Formula | C28H29ClN2O |
| Molecular Weight | 445.01 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (3R)-N-benzyl-3-(4-chlorophenyl)-3-(1,7-diethylindol-3-yl)propanamide |
| SMILES | CCc1cccc2c([C@H](CC(=O)NCc3ccccc3)c3ccc(Cl)cc3)cn(CC)c12 |
| InChI | InChI=1S/C28H29ClN2O/c1-3-21-11-8-12-24-26(19-31(4-2)28(21)24)25(22-13-15-23(29)16-14-22)17-27(32)30-18-20-9-6-5-7-10-20/h5-16,19,25H,3-4,17-18H2,1-2H3,(H,30,32)/t25-/m1/s1 |
| InChIKey | CEWLFWBFCVTBEB-RUZDIDTESA-N |
| XLogP | 6.72 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.01 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |