C18H17N3O5S — CID 1294300
4-methoxy-3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-phenylbenzamide (PubChem CID 1294300) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is 4-methoxy-3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-phenylbenzamide.
| Compound Name | 4-methoxy-3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 1294300 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 4-methoxy-3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-phenylbenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccccc2)cc1S(=O)(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C18H17N3O5S/c1-12-10-17(20-26-12)21-27(23,24)16-11-13(8-9-15(16)25-2)18(22)19-14-6-4-3-5-7-14/h3-11H,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | IKLSOEPTALVFOD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |